C21H27O4P — CID 139495312
[(3Z,7E,9Z)-6,6-dimethyl-5-methylidenedodeca-1,3,7,9,11-pentaen-2-yl] [(3E)-hexa-1,3,5-trien-3-yl] hydrogen phosphate (PubChem CID 139495312) has the molecular formula C21H27O4P and a molecular weight of 374.42 g/mol. Its IUPAC name is [(3Z,7E,9Z)-6,6-dimethyl-5-methylidenedodeca-1,3,7,9,11-pentaen-2-yl] [(3E)-hexa-1,3,5-trien-3-yl] hydrogen phosphate.
| Compound Name | [(3Z,7E,9Z)-6,6-dimethyl-5-methylidenedodeca-1,3,7,9,11-pentaen-2-yl] [(3E)-hexa-1,3,5-trien-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 139495312 |
| Molecular Formula | C21H27O4P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(3Z,7E,9Z)-6,6-dimethyl-5-methylidenedodeca-1,3,7,9,11-pentaen-2-yl] [(3E)-hexa-1,3,5-trien-3-yl] hydrogen phosphate |
| SMILES | C=C/C=C\C=C\C(C)(C)C(=C)/C=C\C(=C)OP(=O)(O)O/C(C=C)=C/C=C |
| InChI | InChI=1S/C21H27O4P/c1-8-11-12-13-17-21(6,7)18(4)15-16-19(5)24-26(22,23)25-20(10-3)14-9-2/h8-17H,1-5H2,6-7H3,(H,22,23)/b12-11-,16-15-,17-13+,20-14+ |
| InChIKey | LQKDATBIJBWPHU-LQPNSJBYSA-N |
| XLogP | 6.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|