C35H21N7 — CID 139495629
10-(4-phenyl-6-quinazolin-2-ylpyrimidin-2-yl)-1,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-2,4,6,8,11,13,15,17,19-nonaene (PubChem CID 139495629) has the molecular formula C35H21N7 and a molecular weight of 539.60 g/mol. Its IUPAC name is 10-(4-phenyl-6-quinazolin-2-ylpyrimidin-2-yl)-1,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-2,4,6,8,11,13,15,17,19-nonaene.
| Compound Name | 10-(4-phenyl-6-quinazolin-2-ylpyrimidin-2-yl)-1,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-2,4,6,8,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 139495629 |
| Molecular Formula | C35H21N7 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 10-(4-phenyl-6-quinazolin-2-ylpyrimidin-2-yl)-1,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-2,4,6,8,11,13,15,17,19-nonaene |
| SMILES | c1ccc(-c2cc(-c3ncc4ccccc4n3)nc(-n3c4ccccc4c4cn5c(cc43)nc3ccccc35)n2)cc1 |
| InChI | InChI=1S/C35H21N7/c1-2-10-22(11-3-1)28-18-29(34-36-20-23-12-4-6-14-26(23)38-34)40-35(39-28)42-30-16-8-5-13-24(30)25-21-41-31-17-9-7-15-27(31)37-33(41)19-32(25)42/h1-21H |
| InChIKey | VAXURIIJHVBPMN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |