C18H24N2 — CID 139496459
10-[(4-ethenylphenyl)methyl]-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 139496459) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 10-[(4-ethenylphenyl)methyl]-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | 10-[(4-ethenylphenyl)methyl]-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 139496459 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 10-[(4-ethenylphenyl)methyl]-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | C=Cc1ccc(CC2CCCCN3CCCN=C23)cc1 |
| InChI | InChI=1S/C18H24N2/c1-2-15-7-9-16(10-8-15)14-17-6-3-4-12-20-13-5-11-19-18(17)20/h2,7-10,17H,1,3-6,11-14H2 |
| InChIKey | VKOGGKSPEKWJLQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |