C17H29NO3 — CID 139496818
(E)-1-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-5,5-dimethyloct-2-en-4-one (PubChem CID 139496818) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (E)-1-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-5,5-dimethyloct-2-en-4-one.
| Compound Name | (E)-1-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-5,5-dimethyloct-2-en-4-one |
|---|---|
| PubChem CID | 139496818 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (E)-1-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-5,5-dimethyloct-2-en-4-one |
| SMILES | CCCC(C)(C)C(=O)/C=C/CN1CC[C@H]2OCCO[C@H]2C1 |
| InChI | InChI=1S/C17H29NO3/c1-4-8-17(2,3)16(19)6-5-9-18-10-7-14-15(13-18)21-12-11-20-14/h5-6,14-15H,4,7-13H2,1-3H3/b6-5+/t14-,15+/m1/s1 |
| InChIKey | JCWYWMKXIFWMJW-MUHKLVGJSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|