C28H28N2O12S — CID 139497157
methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 139497157) has the molecular formula C28H28N2O12S and a molecular weight of 616.60 g/mol. Its IUPAC name is methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 139497157 |
| Molecular Formula | C28H28N2O12S |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | methyl 2-[1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(=O)c2cn(C3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)c3ccccc23)n1 |
| InChI | InChI=1S/C28H28N2O12S/c1-13(31)38-11-21-23(39-14(2)32)24(40-15(3)33)25(41-16(4)34)27(42-21)30-10-18(17-8-6-7-9-20(17)30)22(35)26-29-19(12-43-26)28(36)37-5/h6-10,12,21,23-25,27H,11H2,1-5H3 |
| InChIKey | PIEJNDMLOMEJAV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 175.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|