C28H31N3O8 — CID 139497408
N-[[(12S,13S)-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl]-2-oxoacetamide (PubChem CID 139497408) has the molecular formula C28H31N3O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is N-[[(12S,13S)-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl]-2-oxoacetamide.
| Compound Name | N-[[(12S,13S)-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 139497408 |
| Molecular Formula | C28H31N3O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N-[[(12S,13S)-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl]-2-oxoacetamide |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C1C3CC4=C(C(=O)C(OC)=C(C)C4=O)C(CNC(=O)C=O)N3[C@@H](C)[C@H](C2)N1C |
| InChI | InChI=1S/C28H31N3O8/c1-11-23(34)14-8-17-22-21-15(24(35)12(2)28(39-6)26(21)37)7-16(30(22)4)13(3)31(17)18(9-29-19(33)10-32)20(14)25(36)27(11)38-5/h10,13,16-18,22H,7-9H2,1-6H3,(H,29,33)/t13-,16-,17?,18?,22?/m0/s1 |
| InChIKey | GNHVYEXRHQPHDW-RBSMPCKTSA-N |
| XLogP | -0.04 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|