About methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate
methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 139497459) has the molecular formula C20H20N2O7S
and a molecular weight of 432.45 g/mol. Its IUPAC name is methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 139497459 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOCC(=O)OCn1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O7S/c1-26-7-8-28-10-17(23)29-12-22-9-14(13-5-3-4-6-16(13)22)18(24)19-21-15(11-30-19)20(25)27-2/h3-6,9,11H,7-8,10,12H2,1-2H3 |
| InChIKey | CIVFFZZQCURQNY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (CID 139497459) is methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate is COCCOCC(=O)OCn1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccccc21.
What is the InChIKey of methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate?
The InChIKey is CIVFFZZQCURQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O7S/c1-26-7-8-28-10-17(23)29-12-22-9-14(13-5-3-4-6-16(13)22)18(24)19-21-15(11-30-19)20(25)27-2/h3-6,9,11H,7-8,10,12H2,1-2H3.
What are the key properties of methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate?
methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate has a molecular weight of 432.45 g/mol, XLogP of 2.28, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[[2-(2-methoxyethoxy)acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 139497459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).