C16H18ClFO4 — CID 139498053
6-chloro-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-4-fluoro-3,4-dihydro-1H-isochromene (PubChem CID 139498053) has the molecular formula C16H18ClFO4 and a molecular weight of 328.77 g/mol. Its IUPAC name is 6-chloro-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-4-fluoro-3,4-dihydro-1H-isochromene.
| Compound Name | 6-chloro-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-4-fluoro-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 139498053 |
| Molecular Formula | C16H18ClFO4 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 6-chloro-1-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-4-fluoro-3,4-dihydro-1H-isochromene |
| SMILES | CC1(C)OC2COC(C3OCC(F)c4cc(Cl)ccc43)C2O1 |
| InChI | InChI=1S/C16H18ClFO4/c1-16(2)21-12-7-20-15(14(12)22-16)13-9-4-3-8(17)5-10(9)11(18)6-19-13/h3-5,11-15H,6-7H2,1-2H3 |
| InChIKey | RIFYDWOPRGFAPK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |