C38H44N2O6S2 — CID 139498366
N-[2-[2-[4,4-bis(4-hydroxyphenyl)pentanoylamino]ethyldisulfanyl]ethyl]-4,4-bis(4-hydroxyphenyl)pentanamide (PubChem CID 139498366) has the molecular formula C38H44N2O6S2 and a molecular weight of 688.91 g/mol. Its IUPAC name is N-[2-[2-[4,4-bis(4-hydroxyphenyl)pentanoylamino]ethyldisulfanyl]ethyl]-4,4-bis(4-hydroxyphenyl)pentanamide.
| Compound Name | N-[2-[2-[4,4-bis(4-hydroxyphenyl)pentanoylamino]ethyldisulfanyl]ethyl]-4,4-bis(4-hydroxyphenyl)pentanamide |
|---|---|
| PubChem CID | 139498366 |
| Molecular Formula | C38H44N2O6S2 |
| Molecular Weight | 688.91 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | N-[2-[2-[4,4-bis(4-hydroxyphenyl)pentanoylamino]ethyldisulfanyl]ethyl]-4,4-bis(4-hydroxyphenyl)pentanamide |
| SMILES | CC(CCC(=O)NCCSSCCNC(=O)CCC(C)(c1ccc(O)cc1)c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C38H44N2O6S2/c1-37(27-3-11-31(41)12-4-27,28-5-13-32(42)14-6-28)21-19-35(45)39-23-25-47-48-26-24-40-36(46)20-22-38(2,29-7-15-33(43)16-8-29)30-9-17-34(44)18-10-30/h3-18,41-44H,19-26H2,1-2H3,(H,39,45)(H,40,46) |
| InChIKey | ASINCUFAIBDFHD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.91 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|