C26H24Cl2N6O4S2 — CID 139499798
5-chloro-N-[5-[4-[5-[[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-hydroxymethyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 139499798) has the molecular formula C26H24Cl2N6O4S2 and a molecular weight of 619.56 g/mol. Its IUPAC name is 5-chloro-N-[5-[4-[5-[[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-hydroxymethyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[5-[4-[5-[[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-hydroxymethyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 139499798 |
| Molecular Formula | C26H24Cl2N6O4S2 |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | 5-chloro-N-[5-[4-[5-[[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-hydroxymethyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1nnc(CCCCc2nnc(NC(O)C3Cc4cc(Cl)ccc4O3)s2)s1)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C26H24Cl2N6O4S2/c27-15-5-7-17-13(9-15)11-19(37-17)23(35)29-25-33-31-21(39-25)3-1-2-4-22-32-34-26(40-22)30-24(36)20-12-14-10-16(28)6-8-18(14)38-20/h5-10,19-20,23,35H,1-4,11-12H2,(H,29,33)(H,30,34,36) |
| InChIKey | FPSYQMPJULUNBO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|