C23H26F4N4O — CID 139499906
6'-fluoro-1'-[[5-methyl-1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one (PubChem CID 139499906) has the molecular formula C23H26F4N4O and a molecular weight of 450.48 g/mol. Its IUPAC name is 6'-fluoro-1'-[[5-methyl-1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one.
| Compound Name | 6'-fluoro-1'-[[5-methyl-1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 139499906 |
| Molecular Formula | C23H26F4N4O |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 6'-fluoro-1'-[[5-methyl-1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[azetidine-3,3'-indole]-2'-one |
| SMILES | CC1CCc2c(nc(CN3C(=O)C4(CNC4)c4ccc(F)cc43)n2CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C23H26F4N4O/c1-14-3-6-18-17(9-14)29-20(30(18)8-2-7-23(25,26)27)11-31-19-10-15(24)4-5-16(19)22(21(31)32)12-28-13-22/h4-5,10,14,28H,2-3,6-9,11-13H2,1H3 |
| InChIKey | IUTUUPBUMMKOMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |