C30H39F2N3O3 — CID 139500384
propan-2-yl 1'-[[1-(2,4-difluoro-2-methylbutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]-2'-oxospiro[cyclohexane-3,3'-indole]-1-carboxylate (PubChem CID 139500384) has the molecular formula C30H39F2N3O3 and a molecular weight of 527.66 g/mol. Its IUPAC name is propan-2-yl 1'-[[1-(2,4-difluoro-2-methylbutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]-2'-oxospiro[cyclohexane-3,3'-indole]-1-carboxylate.
| Compound Name | propan-2-yl 1'-[[1-(2,4-difluoro-2-methylbutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]-2'-oxospiro[cyclohexane-3,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 139500384 |
| Molecular Formula | C30H39F2N3O3 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | propan-2-yl 1'-[[1-(2,4-difluoro-2-methylbutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]-2'-oxospiro[cyclohexane-3,3'-indole]-1-carboxylate |
| SMILES | CC(C)OC(=O)C1CCCC2(C1)C(=O)N(Cc1nc3c(n1CC(C)(F)CCF)CCCC3)c1ccccc12 |
| InChI | InChI=1S/C30H39F2N3O3/c1-20(2)38-27(36)21-9-8-14-30(17-21)22-10-4-6-12-24(22)34(28(30)37)18-26-33-23-11-5-7-13-25(23)35(26)19-29(3,32)15-16-31/h4,6,10,12,20-21H,5,7-9,11,13-19H2,1-3H3 |
| InChIKey | LWADBGJLAPQVCS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |