C45H28F6N6 — CID 139500797
2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 139500797) has the molecular formula C45H28F6N6 and a molecular weight of 766.75 g/mol. Its IUPAC name is 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139500797 |
| Molecular Formula | C45H28F6N6 |
| Molecular Weight | 766.75 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | FC(F)(F)C(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C45H28F6N6/c46-44(47,48)43(45(49,50)51,35-25-21-33(22-26-35)41-54-37(29-13-5-1-6-14-29)52-38(55-41)30-15-7-2-8-16-30)36-27-23-34(24-28-36)42-56-39(31-17-9-3-10-18-31)53-40(57-42)32-19-11-4-12-20-32/h1-28H |
| InChIKey | FQAMKNJOLYXGTO-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.75 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |