C49H32F6N2 — CID 139500882
4-[4-[2-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,6-diphenylpyridine (PubChem CID 139500882) has the molecular formula C49H32F6N2 and a molecular weight of 762.80 g/mol. Its IUPAC name is 4-[4-[2-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[4-[2-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 139500882 |
| Molecular Formula | C49H32F6N2 |
| Molecular Weight | 762.80 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | 4-[4-[2-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,6-diphenylpyridine |
| SMILES | FC(F)(F)C(c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1)(c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C49H32F6N2/c50-48(51,52)47(49(53,54)55,41-25-21-33(22-26-41)39-29-43(35-13-5-1-6-14-35)56-44(30-39)36-15-7-2-8-16-36)42-27-23-34(24-28-42)40-31-45(37-17-9-3-10-18-37)57-46(32-40)38-19-11-4-12-20-38/h1-32H |
| InChIKey | HMAODCODOQLPCS-UHFFFAOYSA-N |
| XLogP | 13.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.80 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |