C26H4F8N4 — CID 139501524
2-[12-(dicyanomethylidene)-1,2,3,4,6,7,8,9-octafluoro-3,4-dihydroindeno[2,1-b]fluoren-10-ylidene]propanedinitrile (PubChem CID 139501524) has the molecular formula C26H4F8N4 and a molecular weight of 524.33 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-1,2,3,4,6,7,8,9-octafluoro-3,4-dihydroindeno[2,1-b]fluoren-10-ylidene]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-1,2,3,4,6,7,8,9-octafluoro-3,4-dihydroindeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139501524 |
| Molecular Formula | C26H4F8N4 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-1,2,3,4,6,7,8,9-octafluoro-3,4-dihydroindeno[2,1-b]fluoren-10-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2=C(c3cc4c(cc31)C(=C(C#N)C#N)c1c(F)c(F)c(F)c(F)c1-4)C(F)C(F)C(F)=C2F |
| InChI | InChI=1S/C26H4F8N4/c27-19-15-11-2-12-10(1-9(11)13(7(3-35)4-36)17(15)21(29)25(33)23(19)31)14(8(5-37)6-38)18-16(12)20(28)24(32)26(34)22(18)30/h1-2,19,23H |
| InChIKey | RVONHJGQVQRCEK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|