C17H32N2O — CID 139502115
N,N,N'-trimethyl-N'-[2-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]ethyl]ethane-1,2-diamine (PubChem CID 139502115) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]ethyl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[2-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 139502115 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]ethyl]ethane-1,2-diamine |
| SMILES | C=CC(=C)CC/C=C(\C)COCCN(C)CCN(C)C |
| InChI | InChI=1S/C17H32N2O/c1-7-16(2)9-8-10-17(3)15-20-14-13-19(6)12-11-18(4)5/h7,10H,1-2,8-9,11-15H2,3-6H3/b17-10+ |
| InChIKey | ZCSVSLJXXCIANF-LICLKQGHSA-N |
| XLogP | 2.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|