C19H37NO — CID 139502223
3-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine (PubChem CID 139502223) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is 3-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 139502223 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | 3-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCCCC/C=C(/C)CC/C=C(\C)COCCCN(C)C |
| InChI | InChI=1S/C19H37NO/c1-6-7-8-9-12-18(2)13-10-14-19(3)17-21-16-11-15-20(4)5/h12,14H,6-11,13,15-17H2,1-5H3/b18-12-,19-14+ |
| InChIKey | ZNEMACMLEMONAZ-ZUQSFNSISA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|