C20H23N5OS — CID 139502370
N-[3-[(5-methoxy-1,3-dihydroisoindol-2-yl)sulfanylmethyl]cyclobutyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 139502370) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-[3-[(5-methoxy-1,3-dihydroisoindol-2-yl)sulfanylmethyl]cyclobutyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-[(5-methoxy-1,3-dihydroisoindol-2-yl)sulfanylmethyl]cyclobutyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139502370 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[3-[(5-methoxy-1,3-dihydroisoindol-2-yl)sulfanylmethyl]cyclobutyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc2c(c1)CN(SCC1CC(Nc3ncnc4[nH]ccc34)C1)C2 |
| InChI | InChI=1S/C20H23N5OS/c1-26-17-3-2-14-9-25(10-15(14)8-17)27-11-13-6-16(7-13)24-20-18-4-5-21-19(18)22-12-23-20/h2-5,8,12-13,16H,6-7,9-11H2,1H3,(H2,21,22,23,24) |
| InChIKey | VUHLJPHWFJPYLT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|