C28H18N4O7S2 — CID 139502850
7-(2-methyl-4-phenoxyphenyl)-3-(4-nitrophenyl)sulfonylcarbonyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 139502850) has the molecular formula C28H18N4O7S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-3-(4-nitrophenyl)sulfonylcarbonyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-3-(4-nitrophenyl)sulfonylcarbonyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 139502850 |
| Molecular Formula | C28H18N4O7S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-3-(4-nitrophenyl)sulfonylcarbonyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)sc3nccc1c23 |
| InChI | InChI=1S/C28H18N4O7S2/c1-16-15-19(39-18-5-3-2-4-6-18)9-12-21(16)31-22-13-14-29-26-23(22)24(30-28(31)34)25(40-26)27(33)41(37,38)20-10-7-17(8-11-20)32(35)36/h2-15H,1H3,(H,30,34) |
| InChIKey | IRYIZBHXPMKITC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|