C17H28N2O3 — CID 139502929
(2E)-2-[2-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]ethylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 139502929) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2E)-2-[2-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]ethylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[2-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]ethylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 139502929 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (2E)-2-[2-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]ethylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CCN(C/C=C(\C#N)C(=O)C(C)(C)C)C[C@@H]1OCCO[C@@H]1C |
| InChI | InChI=1S/C17H28N2O3/c1-6-19(12-15-13(2)21-9-10-22-15)8-7-14(11-18)16(20)17(3,4)5/h7,13,15H,6,8-10,12H2,1-5H3/b14-7+/t13-,15+/m1/s1 |
| InChIKey | YDUUIMNPPFNMPB-ZIMXLHHISA-N |
| XLogP | 2.18 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|