C24H43N — CID 139502968
4,4,5,8,8,9-hexamethyl-N-(5-methyl-4-methylidenehex-5-enyl)deca-1,9-dien-2-amine (PubChem CID 139502968) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is 4,4,5,8,8,9-hexamethyl-N-(5-methyl-4-methylidenehex-5-enyl)deca-1,9-dien-2-amine.
| Compound Name | 4,4,5,8,8,9-hexamethyl-N-(5-methyl-4-methylidenehex-5-enyl)deca-1,9-dien-2-amine |
|---|---|
| PubChem CID | 139502968 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | 4,4,5,8,8,9-hexamethyl-N-(5-methyl-4-methylidenehex-5-enyl)deca-1,9-dien-2-amine |
| SMILES | C=C(CC(C)(C)C(C)CCC(C)(C)C(=C)C)NCCCC(=C)C(=C)C |
| InChI | InChI=1S/C24H43N/c1-18(2)20(5)13-12-16-25-22(7)17-24(10,11)21(6)14-15-23(8,9)19(3)4/h21,25H,1,3,5,7,12-17H2,2,4,6,8-11H3 |
| InChIKey | QIAPJKKHGMXWQH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|