C25H29F6N3O3S — CID 139502991
2-[4-[2-ethyl-6-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]-3-pyridinyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 139502991) has the molecular formula C25H29F6N3O3S and a molecular weight of 565.58 g/mol. Its IUPAC name is 2-[4-[2-ethyl-6-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]-3-pyridinyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[2-ethyl-6-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]-3-pyridinyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 139502991 |
| Molecular Formula | C25H29F6N3O3S |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-[4-[2-ethyl-6-[(8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methyl]-3-pyridinyl]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCc1nc(CN2CC3CCC(C2)N3S(C)(=O)=O)ccc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C25H29F6N3O3S/c1-4-22-21(20-9-5-16(11-15(20)2)23(35,24(26,27)28)25(29,30)31)10-6-17(32-22)12-33-13-18-7-8-19(14-33)34(18)38(3,36)37/h5-6,9-11,18-19,35H,4,7-8,12-14H2,1-3H3 |
| InChIKey | NTFYAXCOGSCQNQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |