C26H26ClN7O — CID 139503163
7-(2-chlorophenyl)-12-[4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503163) has the molecular formula C26H26ClN7O and a molecular weight of 488.00 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-12-[4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 7-(2-chlorophenyl)-12-[4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503163 |
| Molecular Formula | C26H26ClN7O |
| Molecular Weight | 488.00 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 7-(2-chlorophenyl)-12-[4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | CN1CCN(c2ccc(Nc3cc4c(cn3)C(=O)N(c3ccccc3Cl)C3=NCCN34)cc2)CC1 |
| InChI | InChI=1S/C26H26ClN7O/c1-31-12-14-32(15-13-31)19-8-6-18(7-9-19)30-24-16-23-20(17-29-24)25(35)34(26-28-10-11-33(23)26)22-5-3-2-4-21(22)27/h2-9,16-17H,10-15H2,1H3,(H,29,30) |
| InChIKey | YMFAKANURAVFGL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.00 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|