C17H28N2 — CID 139504048
(Z,2Z,3E)-N-but-1-en-2-yl-3-ethylidene-6-imino-N-methyl-2-propylidenehept-4-en-1-amine (PubChem CID 139504048) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (Z,2Z,3E)-N-but-1-en-2-yl-3-ethylidene-6-imino-N-methyl-2-propylidenehept-4-en-1-amine.
| Compound Name | (Z,2Z,3E)-N-but-1-en-2-yl-3-ethylidene-6-imino-N-methyl-2-propylidenehept-4-en-1-amine |
|---|---|
| PubChem CID | 139504048 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (Z,2Z,3E)-N-but-1-en-2-yl-3-ethylidene-6-imino-N-methyl-2-propylidenehept-4-en-1-amine |
| SMILES | [H]/N=C(C)/C=C\C(=C/C)\C(=C\CC)CN(C)C(=C)CC |
| InChI | InChI=1S/C17H28N2/c1-7-10-17(13-19(6)15(5)8-2)16(9-3)12-11-14(4)18/h9-12,18H,5,7-8,13H2,1-4,6H3/b12-11-,16-9+,17-10+,18-14+ |
| InChIKey | BNGROHJYGYPYAI-SLCKZLBZSA-N |
| XLogP | 4.72 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|