C17H28O7S — CID 139504178
1,3-bis(cyclohexylmethoxy)-1,3-dioxopropane-2-sulfonic acid (PubChem CID 139504178) has the molecular formula C17H28O7S and a molecular weight of 376.47 g/mol. Its IUPAC name is 1,3-bis(cyclohexylmethoxy)-1,3-dioxopropane-2-sulfonic acid.
| Compound Name | 1,3-bis(cyclohexylmethoxy)-1,3-dioxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 139504178 |
| Molecular Formula | C17H28O7S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1,3-bis(cyclohexylmethoxy)-1,3-dioxopropane-2-sulfonic acid |
| SMILES | O=C(OCC1CCCCC1)C(C(=O)OCC1CCCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C17H28O7S/c18-16(23-11-13-7-3-1-4-8-13)15(25(20,21)22)17(19)24-12-14-9-5-2-6-10-14/h13-15H,1-12H2,(H,20,21,22) |
| InChIKey | UOCWHNUMXMBRSO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|