About 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane
7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane (PubChem CID 139504363) has the molecular formula C14H14F4N2O
and a molecular weight of 302.27 g/mol. Its IUPAC name is 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane.
Molecular Properties
| Compound Name | 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane |
| PubChem CID | 139504363 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane |
| SMILES | CN1CC2CC23CC(Oc2ncc(C(F)(F)F)cc2F)C13 |
| InChI | InChI=1S/C14H14F4N2O/c1-20-6-8-3-13(8)4-10(11(13)20)21-12-9(15)2-7(5-19-12)14(16,17)18/h2,5,8,10-11H,3-4,6H2,1H3 |
| InChIKey | CCLSDPSCLWGKMW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The IUPAC name of 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane (CID 139504363) is 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane.
What is the SMILES notation for 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The canonical SMILES for 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane is CN1CC2CC23CC(Oc2ncc(C(F)(F)F)cc2F)C13.
What is the InChIKey of 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
The InChIKey is CCLSDPSCLWGKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F4N2O/c1-20-6-8-3-13(8)4-10(11(13)20)21-12-9(15)2-7(5-19-12)14(16,17)18/h2,5,8,10-11H,3-4,6H2,1H3.
What are the key properties of 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane?
7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane has a molecular weight of 302.27 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-5-azatricyclo[4.2.0.01,3]octane is sourced from PubChem (CID 139504363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).