C19H18N4O4S — CID 139504783
4-[(7,8-dimethoxyimidazo[4,5-c]quinolin-1-yl)methyl]benzenesulfonamide (PubChem CID 139504783) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-[(7,8-dimethoxyimidazo[4,5-c]quinolin-1-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(7,8-dimethoxyimidazo[4,5-c]quinolin-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139504783 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-[(7,8-dimethoxyimidazo[4,5-c]quinolin-1-yl)methyl]benzenesulfonamide |
| SMILES | COc1cc2ncc3ncn(Cc4ccc(S(N)(=O)=O)cc4)c3c2cc1OC |
| InChI | InChI=1S/C19H18N4O4S/c1-26-17-7-14-15(8-18(17)27-2)21-9-16-19(14)23(11-22-16)10-12-3-5-13(6-4-12)28(20,24)25/h3-9,11H,10H2,1-2H3,(H2,20,24,25) |
| InChIKey | JSUBILDIWOCLJS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |