C13H21NO2 — CID 139505337
(1R,3Z,5E)-5-methoxy-2-methylidene-1-[(2S)-pyrrolidin-2-yl]hepta-3,5-dien-1-ol (PubChem CID 139505337) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (1R,3Z,5E)-5-methoxy-2-methylidene-1-[(2S)-pyrrolidin-2-yl]hepta-3,5-dien-1-ol.
| Compound Name | (1R,3Z,5E)-5-methoxy-2-methylidene-1-[(2S)-pyrrolidin-2-yl]hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 139505337 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (1R,3Z,5E)-5-methoxy-2-methylidene-1-[(2S)-pyrrolidin-2-yl]hepta-3,5-dien-1-ol |
| SMILES | C=C(/C=C\C(=C/C)OC)[C@@H](O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H21NO2/c1-4-11(16-3)8-7-10(2)13(15)12-6-5-9-14-12/h4,7-8,12-15H,2,5-6,9H2,1,3H3/b8-7-,11-4+/t12-,13+/m0/s1 |
| InChIKey | LFLJLMIASIWAPA-YGYBCRMLSA-N |
| XLogP | 1.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|