C16H15ClN4OS — CID 139505489
4-amino-N-(1,2,3-benzothiadiazol-6-yl)-3-(4-chlorophenyl)butanamide (PubChem CID 139505489) has the molecular formula C16H15ClN4OS and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-3-(4-chlorophenyl)butanamide.
| Compound Name | 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-3-(4-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 139505489 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-3-(4-chlorophenyl)butanamide |
| SMILES | NCC(CC(=O)Nc1ccc2nnsc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4OS/c17-12-3-1-10(2-4-12)11(9-18)7-16(22)19-13-5-6-14-15(8-13)23-21-20-14/h1-6,8,11H,7,9,18H2,(H,19,22) |
| InChIKey | AFPGLNHGHKCVNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |