About 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide
4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide (PubChem CID 139505539) has the molecular formula C16H15ClN4OS
and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide.
Molecular Properties
| Compound Name | 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide |
| PubChem CID | 139505539 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide |
| SMILES | NCCC(C(=O)Nc1ccc2nnsc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4OS/c17-11-3-1-10(2-4-11)13(7-8-18)16(22)19-12-5-6-14-15(9-12)23-21-20-14/h1-6,9,13H,7-8,18H2,(H,19,22) |
| InChIKey | GISFMNRQLJNFRT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide?
The IUPAC name of 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide (CID 139505539) is 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide.
What is the SMILES notation for 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide?
The canonical SMILES for 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide is NCCC(C(=O)Nc1ccc2nnsc2c1)c1ccc(Cl)cc1.
What is the InChIKey of 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide?
The InChIKey is GISFMNRQLJNFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4OS/c17-11-3-1-10(2-4-11)13(7-8-18)16(22)19-12-5-6-14-15(9-12)23-21-20-14/h1-6,9,13H,7-8,18H2,(H,19,22).
What are the key properties of 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide?
4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide has a molecular weight of 346.84 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(1,2,3-benzothiadiazol-6-yl)-2-(4-chlorophenyl)butanamide is sourced from PubChem (CID 139505539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).