C19H22F2N2 — CID 139506324
N-[[4-[3-(difluoromethyl)phenyl]phenyl]methyl]-1-pyrrolidin-2-ylmethanamine (PubChem CID 139506324) has the molecular formula C19H22F2N2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[4-[3-(difluoromethyl)phenyl]phenyl]methyl]-1-pyrrolidin-2-ylmethanamine.
| Compound Name | N-[[4-[3-(difluoromethyl)phenyl]phenyl]methyl]-1-pyrrolidin-2-ylmethanamine |
|---|---|
| PubChem CID | 139506324 |
| Molecular Formula | C19H22F2N2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[[4-[3-(difluoromethyl)phenyl]phenyl]methyl]-1-pyrrolidin-2-ylmethanamine |
| SMILES | FC(F)c1cccc(-c2ccc(CNCC3CCCN3)cc2)c1 |
| InChI | InChI=1S/C19H22F2N2/c20-19(21)17-4-1-3-16(11-17)15-8-6-14(7-9-15)12-22-13-18-5-2-10-23-18/h1,3-4,6-9,11,18-19,22-23H,2,5,10,12-13H2 |
| InChIKey | HAGPORXQQXHXLO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |