About (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine
(E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine (PubChem CID 139506395) has the molecular formula C19H32F3N3
and a molecular weight of 359.48 g/mol. Its IUPAC name is (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine.
Molecular Properties
| Compound Name | (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine |
| PubChem CID | 139506395 |
| Molecular Formula | C19H32F3N3 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine |
| SMILES | CCCC(/C=C(\C(C)CC)C1C=NC(C(F)(F)F)=CN1C)N(C)CC |
| InChI | InChI=1S/C19H32F3N3/c1-7-10-15(24(5)9-3)11-16(14(4)8-2)17-12-23-18(13-25(17)6)19(20,21)22/h11-15,17H,7-10H2,1-6H3/b16-11+ |
| InChIKey | WFXOTLYRIPDGMK-LFIBNONCSA-N |
| XLogP | 4.87 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine?
The IUPAC name of (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine (CID 139506395) is (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine.
What is the SMILES notation for (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine?
The canonical SMILES for (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine is CCCC(/C=C(\C(C)CC)C1C=NC(C(F)(F)F)=CN1C)N(C)CC.
What is the InChIKey of (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine?
The InChIKey is WFXOTLYRIPDGMK-LFIBNONCSA-N. The full InChI is InChI=1S/C19H32F3N3/c1-7-10-15(24(5)9-3)11-16(14(4)8-2)17-12-23-18(13-25(17)6)19(20,21)22/h11-15,17H,7-10H2,1-6H3/b16-11+.
What are the key properties of (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine?
(E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine has a molecular weight of 359.48 g/mol, XLogP of 4.87, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethyl-N,7-dimethyl-6-[1-methyl-5-(trifluoromethyl)-2H-pyrazin-2-yl]non-5-en-4-amine is sourced from PubChem (CID 139506395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).