C18H25F3N4O — CID 139506440
N-[(2E,4E,5Z,7Z)-5,8-diamino-9,9,9-trifluoro-2-methyl-4-prop-2-enylidenenona-2,5,7-trienyl]pyrrolidine-2-carboxamide (PubChem CID 139506440) has the molecular formula C18H25F3N4O and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[(2E,4E,5Z,7Z)-5,8-diamino-9,9,9-trifluoro-2-methyl-4-prop-2-enylidenenona-2,5,7-trienyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2E,4E,5Z,7Z)-5,8-diamino-9,9,9-trifluoro-2-methyl-4-prop-2-enylidenenona-2,5,7-trienyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139506440 |
| Molecular Formula | C18H25F3N4O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[(2E,4E,5Z,7Z)-5,8-diamino-9,9,9-trifluoro-2-methyl-4-prop-2-enylidenenona-2,5,7-trienyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C=C(\C=C(/C)CNC(=O)C1CCCN1)C(/N)=C\C=C(/N)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N4O/c1-3-5-13(14(22)7-8-16(23)18(19,20)21)10-12(2)11-25-17(26)15-6-4-9-24-15/h3,5,7-8,10,15,24H,1,4,6,9,11,22-23H2,2H3,(H,25,26)/b12-10+,13-5+,14-7-,16-8- |
| InChIKey | AFTPOHBRUNAWOY-QEKSCMRCSA-N |
| XLogP | 2.16 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|