C19H31N — CID 139506547
2-[(2E,4Z)-2,3-dimethylhexa-2,4-dienyl]-5-(2-methylbutyl)-3,4-dihydro-2H-azepine (PubChem CID 139506547) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-[(2E,4Z)-2,3-dimethylhexa-2,4-dienyl]-5-(2-methylbutyl)-3,4-dihydro-2H-azepine.
| Compound Name | 2-[(2E,4Z)-2,3-dimethylhexa-2,4-dienyl]-5-(2-methylbutyl)-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 139506547 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-[(2E,4Z)-2,3-dimethylhexa-2,4-dienyl]-5-(2-methylbutyl)-3,4-dihydro-2H-azepine |
| SMILES | C/C=C\C(C)=C(/C)CC1CCC(CC(C)CC)=CC=N1 |
| InChI | InChI=1S/C19H31N/c1-6-8-16(4)17(5)14-19-10-9-18(11-12-20-19)13-15(3)7-2/h6,8,11-12,15,19H,7,9-10,13-14H2,1-5H3/b8-6-,17-16+ |
| InChIKey | DZKIIJGFMPNZON-ZWKHAXJNSA-N |
| XLogP | 5.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|