C7H13NO2 — CID 139506611
(2Z,4E)-6-amino-5-methylhexa-2,4-diene-2,3-diol (PubChem CID 139506611) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2Z,4E)-6-amino-5-methylhexa-2,4-diene-2,3-diol.
| Compound Name | (2Z,4E)-6-amino-5-methylhexa-2,4-diene-2,3-diol |
|---|---|
| PubChem CID | 139506611 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2Z,4E)-6-amino-5-methylhexa-2,4-diene-2,3-diol |
| SMILES | C/C(O)=C(O)\C=C(/C)CN |
| InChI | InChI=1S/C7H13NO2/c1-5(4-8)3-7(10)6(2)9/h3,9-10H,4,8H2,1-2H3/b5-3+,7-6- |
| InChIKey | QTQSONTXZRNYLI-WZWXSLMZSA-N |
| XLogP | 1.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|