About N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide
N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide (PubChem CID 139506656) has the molecular formula C10H23N3S
and a molecular weight of 217.38 g/mol. Its IUPAC name is N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide |
| PubChem CID | 139506656 |
| Molecular Formula | C10H23N3S |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide |
| SMILES | CCCCSN(C)CCN/C(C)=N/C |
| InChI | InChI=1S/C10H23N3S/c1-5-6-9-14-13(4)8-7-12-10(2)11-3/h5-9H2,1-4H3,(H,11,12) |
| InChIKey | VAMWVEKSQLMVAB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide?
The IUPAC name of N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide (CID 139506656) is N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide?
The canonical SMILES for N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide is CCCCSN(C)CCN/C(C)=N/C.
What is the InChIKey of N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide?
The InChIKey is VAMWVEKSQLMVAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3S/c1-5-6-9-14-13(4)8-7-12-10(2)11-3/h5-9H2,1-4H3,(H,11,12).
What are the key properties of N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide?
N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide has a molecular weight of 217.38 g/mol, XLogP of 2.00, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[butylsulfanyl(methyl)amino]ethyl]-N'-methylethanimidamide is sourced from PubChem (CID 139506656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).