C12H18F3N — CID 139506661
(4Z)-N-butan-2-yl-1,1,1-trifluoro-6-methylhepta-4,6-dien-2-imine (PubChem CID 139506661) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (4Z)-N-butan-2-yl-1,1,1-trifluoro-6-methylhepta-4,6-dien-2-imine.
| Compound Name | (4Z)-N-butan-2-yl-1,1,1-trifluoro-6-methylhepta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 139506661 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4Z)-N-butan-2-yl-1,1,1-trifluoro-6-methylhepta-4,6-dien-2-imine |
| SMILES | C=C(C)/C=C\C/C(=N/C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N/c1-5-10(4)16-11(12(13,14)15)8-6-7-9(2)3/h6-7,10H,2,5,8H2,1,3-4H3/b7-6-,16-11- |
| InChIKey | XJIFARZVIPLYHI-FOTYMDCYSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|