C18H26F3N — CID 139506706
(2E,4E,8E)-2-methyl-5-methylidene-4-[(E)-pent-2-enylidene]-8-(trifluoromethyl)deca-2,8-dien-1-amine (PubChem CID 139506706) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is (2E,4E,8E)-2-methyl-5-methylidene-4-[(E)-pent-2-enylidene]-8-(trifluoromethyl)deca-2,8-dien-1-amine.
| Compound Name | (2E,4E,8E)-2-methyl-5-methylidene-4-[(E)-pent-2-enylidene]-8-(trifluoromethyl)deca-2,8-dien-1-amine |
|---|---|
| PubChem CID | 139506706 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2E,4E,8E)-2-methyl-5-methylidene-4-[(E)-pent-2-enylidene]-8-(trifluoromethyl)deca-2,8-dien-1-amine |
| SMILES | C=C(CC/C(=C\C)C(F)(F)F)C(/C=C(\C)CN)=C/C=C/CC |
| InChI | InChI=1S/C18H26F3N/c1-5-7-8-9-16(12-14(3)13-22)15(4)10-11-17(6-2)18(19,20)21/h6-9,12H,4-5,10-11,13,22H2,1-3H3/b8-7+,14-12+,16-9+,17-6+ |
| InChIKey | BTHACPFHXDKQCG-ZHSHASEYSA-N |
| XLogP | 5.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|