About 2-ethylsulfonyl-3,3-dimethylbutan-1-ol
2-ethylsulfonyl-3,3-dimethylbutan-1-ol (PubChem CID 139506836) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-ethylsulfonyl-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 2-ethylsulfonyl-3,3-dimethylbutan-1-ol |
| PubChem CID | 139506836 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-ethylsulfonyl-3,3-dimethylbutan-1-ol |
| SMILES | CCS(=O)(=O)C(CO)C(C)(C)C |
| InChI | InChI=1S/C8H18O3S/c1-5-12(10,11)7(6-9)8(2,3)4/h7,9H,5-6H2,1-4H3 |
| InChIKey | WULOTAQQGGJKTI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylsulfonyl-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonyl-3,3-dimethylbutan-1-ol?
The IUPAC name of 2-ethylsulfonyl-3,3-dimethylbutan-1-ol (CID 139506836) is 2-ethylsulfonyl-3,3-dimethylbutan-1-ol.
What is the SMILES notation for 2-ethylsulfonyl-3,3-dimethylbutan-1-ol?
The canonical SMILES for 2-ethylsulfonyl-3,3-dimethylbutan-1-ol is CCS(=O)(=O)C(CO)C(C)(C)C.
What is the InChIKey of 2-ethylsulfonyl-3,3-dimethylbutan-1-ol?
The InChIKey is WULOTAQQGGJKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3S/c1-5-12(10,11)7(6-9)8(2,3)4/h7,9H,5-6H2,1-4H3.
What are the key properties of 2-ethylsulfonyl-3,3-dimethylbutan-1-ol?
2-ethylsulfonyl-3,3-dimethylbutan-1-ol has a molecular weight of 194.30 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonyl-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 139506836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).