C96H79N5 — CID 139507170
2,3,5,6-tetrakis(3-tert-butylcarbazol-9-yl)-4-(9,9'-spirobi[fluorene]-4'-yl)benzonitrile (PubChem CID 139507170) has the molecular formula C96H79N5 and a molecular weight of 1302.72 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(3-tert-butylcarbazol-9-yl)-4-(9,9'-spirobi[fluorene]-4'-yl)benzonitrile.
| Compound Name | 2,3,5,6-tetrakis(3-tert-butylcarbazol-9-yl)-4-(9,9'-spirobi[fluorene]-4'-yl)benzonitrile |
|---|---|
| PubChem CID | 139507170 |
| Molecular Formula | C96H79N5 |
| Molecular Weight | 1302.72 g/mol |
| Exact Mass | 1301.63 |
| IUPAC Name | 2,3,5,6-tetrakis(3-tert-butylcarbazol-9-yl)-4-(9,9'-spirobi[fluorene]-4'-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1c(C#N)c(-n2c3ccccc3c3cc(C(C)(C)C)ccc32)c(-n2c3ccccc3c3cc(C(C)(C)C)ccc32)c(-c2cccc3c2-c2ccccc2C32c3ccccc3-c3ccccc32)c1-n1c2ccccc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C96H79N5/c1-92(2,3)57-44-48-82-69(52-57)63-30-16-23-40-78(63)98(82)88-73(56-97)89(99-79-41-24-17-31-64(79)70-53-58(93(4,5)6)45-49-83(70)99)91(101-81-43-26-19-33-66(81)72-55-60(95(10,11)12)47-51-85(72)101)87(90(88)100-80-42-25-18-32-65(80)71-54-59(94(7,8)9)46-50-84(71)100)68-35-27-39-77-86(68)67-34-15-22-38-76(67)96(77)74-36-20-13-28-61(74)62-29-14-21-37-75(62)96/h13-55H,1-12H3 |
| InChIKey | LOXLQWYHIUDEKF-UHFFFAOYSA-N |
| XLogP | 25.15 |
| TPSA | 43.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1302.72 |
| LogP ≤ 5 | 25.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |