C26H22F3N5O2 — CID 139507339
N-[(8R)-4-amino-5-[4-[4-(trifluoromethyl)phenoxy]phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide (PubChem CID 139507339) has the molecular formula C26H22F3N5O2 and a molecular weight of 493.49 g/mol. Its IUPAC name is N-[(8R)-4-amino-5-[4-[4-(trifluoromethyl)phenoxy]phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide.
| Compound Name | N-[(8R)-4-amino-5-[4-[4-(trifluoromethyl)phenoxy]phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139507339 |
| Molecular Formula | C26H22F3N5O2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[(8R)-4-amino-5-[4-[4-(trifluoromethyl)phenoxy]phenyl]-6,7,8,9-tetrahydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCc2c(-c3ccc(Oc4ccc(C(F)(F)F)cc4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C26H22F3N5O2/c1-2-21(35)33-17-7-12-20-22(23-24(30)31-14-32-25(23)34(20)13-17)15-3-8-18(9-4-15)36-19-10-5-16(6-11-19)26(27,28)29/h2-6,8-11,14,17H,1,7,12-13H2,(H,33,35)(H2,30,31,32)/t17-/m1/s1 |
| InChIKey | DGTBKTPYIGOOJT-QGZVFWFLSA-N |
| XLogP | 5.11 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|