C25H32N6O3 — CID 139507515
3-[2-[[(1S)-1-[4-[1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 139507515) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-[4-[1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[(1S)-1-[4-[1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139507515 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 3-[2-[[(1S)-1-[4-[1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CC(=O)N1CCN(C(CC)c2ccc([C@H](C)Nc3nccc(N4CCOC4=O)n3)cc2)CC1 |
| InChI | InChI=1S/C25H32N6O3/c1-4-21(29-12-14-30(15-13-29)23(32)5-2)20-8-6-19(7-9-20)18(3)27-24-26-11-10-22(28-24)31-16-17-34-25(31)33/h5-11,18,21H,2,4,12-17H2,1,3H3,(H,26,27,28)/t18-,21?/m0/s1 |
| InChIKey | VLZWVMXOKOOBSV-YMXDCFFPSA-N |
| XLogP | 3.39 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|