C45H55Cl2N4O9P — CID 139507765
[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylcarbamoylamino]propan-2-yl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 139507765) has the molecular formula C45H55Cl2N4O9P and a molecular weight of 897.83 g/mol. Its IUPAC name is [1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylcarbamoylamino]propan-2-yl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylcarbamoylamino]propan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 139507765 |
| Molecular Formula | C45H55Cl2N4O9P |
| Molecular Weight | 897.83 g/mol |
| Exact Mass | 896.31 |
| IUPAC Name | [1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylcarbamoylamino]propan-2-yl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1ccc(C(OCC(CNC(=O)NCCCOP(OCCC#N)N(C(C)C)C(C)C)OC(=O)COc2ccc(Cl)cc2Cl)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H55Cl2N4O9P/c1-32(2)51(33(3)4)61(58-26-10-24-48)59-27-11-25-49-44(53)50-29-40(60-43(52)31-56-42-23-18-37(46)28-41(42)47)30-57-45(34-12-8-7-9-13-34,35-14-19-38(54-5)20-15-35)36-16-21-39(55-6)22-17-36/h7-9,12-23,28,32-33,40H,10-11,25-27,29-31H2,1-6H3,(H2,49,50,53) |
| InChIKey | BODLTVNHXVEXQJ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.83 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|