About N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine
N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine (PubChem CID 139507785) has the molecular formula C16H20BrFN4
and a molecular weight of 367.27 g/mol. Its IUPAC name is N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine |
| PubChem CID | 139507785 |
| Molecular Formula | C16H20BrFN4 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1cc(Br)nc(-c2cncc(F)c2)c1 |
| InChI | InChI=1S/C16H20BrFN4/c1-16(2,3)21-5-4-20-13-7-14(22-15(17)8-13)11-6-12(18)10-19-9-11/h6-10,21H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | RVHXZKLBHBPITD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine?
The IUPAC name of N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine (CID 139507785) is N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine.
What is the SMILES notation for N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine?
The canonical SMILES for N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine is CC(C)(C)NCCNc1cc(Br)nc(-c2cncc(F)c2)c1.
What is the InChIKey of N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine?
The InChIKey is RVHXZKLBHBPITD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrFN4/c1-16(2,3)21-5-4-20-13-7-14(22-15(17)8-13)11-6-12(18)10-19-9-11/h6-10,21H,4-5H2,1-3H3,(H,20,22).
What are the key properties of N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine?
N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine has a molecular weight of 367.27 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-bromo-6-(5-fluoro-3-pyridinyl)-4-pyridinyl]-N'-tert-butylethane-1,2-diamine is sourced from PubChem (CID 139507785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).