About 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine
7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine (PubChem CID 139508817) has the molecular formula C16H13N5O
and a molecular weight of 291.31 g/mol. Its IUPAC name is 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine |
| PubChem CID | 139508817 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine |
| SMILES | Cc1occc1-c1nc(N)n2ccnc2c1-c1ccncc1 |
| InChI | InChI=1S/C16H13N5O/c1-10-12(4-9-22-10)14-13(11-2-5-18-6-3-11)15-19-7-8-21(15)16(17)20-14/h2-9H,1H3,(H2,17,20) |
| InChIKey | WLEVMDSFOICAKH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine?
The IUPAC name of 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine (CID 139508817) is 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine.
What is the SMILES notation for 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine?
The canonical SMILES for 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine is Cc1occc1-c1nc(N)n2ccnc2c1-c1ccncc1.
What is the InChIKey of 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine?
The InChIKey is WLEVMDSFOICAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O/c1-10-12(4-9-22-10)14-13(11-2-5-18-6-3-11)15-19-7-8-21(15)16(17)20-14/h2-9H,1H3,(H2,17,20).
What are the key properties of 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine?
7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine has a molecular weight of 291.31 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylfuran-3-yl)-8-pyridin-4-ylimidazo[1,2-c]pyrimidin-5-amine is sourced from PubChem (CID 139508817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).