C16H16Cl2N4OS — CID 139509554
3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(2,3-dichlorophenyl)sulfanyl-1H-pyrazin-2-one (PubChem CID 139509554) has the molecular formula C16H16Cl2N4OS and a molecular weight of 383.30 g/mol. Its IUPAC name is 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(2,3-dichlorophenyl)sulfanyl-1H-pyrazin-2-one.
| Compound Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(2,3-dichlorophenyl)sulfanyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 139509554 |
| Molecular Formula | C16H16Cl2N4OS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(2,3-dichlorophenyl)sulfanyl-1H-pyrazin-2-one |
| SMILES | O=c1[nH]c(Sc2cccc(Cl)c2Cl)cnc1N1CC2CNCC2C1 |
| InChI | InChI=1S/C16H16Cl2N4OS/c17-11-2-1-3-12(14(11)18)24-13-6-20-15(16(23)21-13)22-7-9-4-19-5-10(9)8-22/h1-3,6,9-10,19H,4-5,7-8H2,(H,21,23) |
| InChIKey | VOJJCURZGKSVBY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |