About [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate
[4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate (PubChem CID 139509714) has the molecular formula C14H10F4O6S2
and a molecular weight of 414.35 g/mol. Its IUPAC name is [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate |
| PubChem CID | 139509714 |
| Molecular Formula | C14H10F4O6S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc3c(c2)OCS3(O)O)cc1F)C(F)(F)F |
| InChI | InChI=1S/C14H10F4O6S2/c15-10-5-8(1-3-11(10)24-26(21,22)14(16,17)18)9-2-4-13-12(6-9)23-7-25(13,19)20/h1-6,19-20H,7H2 |
| InChIKey | ANEXGRKYWKAPTJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate (CID 139509714) is [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(-c2ccc3c(c2)OCS3(O)O)cc1F)C(F)(F)F.
What is the InChIKey of [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate?
The InChIKey is ANEXGRKYWKAPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F4O6S2/c15-10-5-8(1-3-11(10)24-26(21,22)14(16,17)18)9-2-4-13-12(6-9)23-7-25(13,19)20/h1-6,19-20H,7H2.
What are the key properties of [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate?
[4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate has a molecular weight of 414.35 g/mol, XLogP of 4.18, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3-dihydroxy-1,3λ4-benzoxathiol-6-yl)-2-fluorophenyl] trifluoromethanesulfonate is sourced from PubChem (CID 139509714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).