C21H22N6O4S — CID 139509974
N-[[2-(cyclopropylsulfonylamino)pyrimidin-4-yl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide (PubChem CID 139509974) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[[2-(cyclopropylsulfonylamino)pyrimidin-4-yl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide.
| Compound Name | N-[[2-(cyclopropylsulfonylamino)pyrimidin-4-yl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 139509974 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[[2-(cyclopropylsulfonylamino)pyrimidin-4-yl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
| SMILES | CCOc1cncc(-c2ccc(C(=O)NCc3ccnc(NS(=O)(=O)C4CC4)n3)cc2)n1 |
| InChI | InChI=1S/C21H22N6O4S/c1-2-31-19-13-22-12-18(26-19)14-3-5-15(6-4-14)20(28)24-11-16-9-10-23-21(25-16)27-32(29,30)17-7-8-17/h3-6,9-10,12-13,17H,2,7-8,11H2,1H3,(H,24,28)(H,23,25,27) |
| InChIKey | ZADDSEXWXKPBMI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |