About 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane
2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane (PubChem CID 139511751) has the molecular formula C6H4F3N3S
and a molecular weight of 207.18 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane.
Molecular Properties
| Compound Name | 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane |
| PubChem CID | 139511751 |
| Molecular Formula | C6H4F3N3S |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane |
| SMILES | FS(F)(F)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H4F3N3S/c7-13(8,9)4-1-2-5-6(3-4)11-12-10-5/h1-3H,(H,10,11,12) |
| InChIKey | JPIJDCWXBBADKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane?
The IUPAC name of 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane (CID 139511751) is 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane.
What is the SMILES notation for 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane?
The canonical SMILES for 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane is FS(F)(F)c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane?
The InChIKey is JPIJDCWXBBADKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N3S/c7-13(8,9)4-1-2-5-6(3-4)11-12-10-5/h1-3H,(H,10,11,12).
What are the key properties of 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane?
2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane has a molecular weight of 207.18 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-5-yl(trifluoro)-λ4-sulfane is sourced from PubChem (CID 139511751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).