C18H28N2O3 — CID 139511865
butyl-[(1R)-1-[4-(3-methylmorpholin-4-yl)phenyl]ethyl]carbamic acid (PubChem CID 139511865) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is butyl-[(1R)-1-[4-(3-methylmorpholin-4-yl)phenyl]ethyl]carbamic acid.
| Compound Name | butyl-[(1R)-1-[4-(3-methylmorpholin-4-yl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 139511865 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | butyl-[(1R)-1-[4-(3-methylmorpholin-4-yl)phenyl]ethyl]carbamic acid |
| SMILES | CCCCN(C(=O)O)[C@H](C)c1ccc(N2CCOCC2C)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-4-5-10-20(18(21)22)15(3)16-6-8-17(9-7-16)19-11-12-23-13-14(19)2/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,21,22)/t14?,15-/m1/s1 |
| InChIKey | FCMVHJFPMNVUFM-YSSOQSIOSA-N |
| XLogP | 3.75 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|